C14H19ClN2O3 — CID 108990819
methyl 3-[[butyl(methyl)carbamoyl]amino]-4-chlorobenzoate (PubChem CID 108990819) has the molecular formula C14H19ClN2O3 and a molecular weight of 298.77 g/mol. Its IUPAC name is methyl 3-[[butyl(methyl)carbamoyl]amino]-4-chlorobenzoate.
| Compound Name | methyl 3-[[butyl(methyl)carbamoyl]amino]-4-chlorobenzoate |
|---|---|
| PubChem CID | 108990819 |
| Molecular Formula | C14H19ClN2O3 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | methyl 3-[[butyl(methyl)carbamoyl]amino]-4-chlorobenzoate |
| SMILES | CCCCN(C)C(=O)Nc1cc(C(=O)OC)ccc1Cl |
| InChI | InChI=1S/C14H19ClN2O3/c1-4-5-8-17(2)14(19)16-12-9-10(13(18)20-3)6-7-11(12)15/h6-7,9H,4-5,8H2,1-3H3,(H,16,19) |
| InChIKey | YPGHUHATBHUFQI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |