C19H22ClN3O3 — CID 109217873
methyl 3-[[4-[butyl(methyl)amino]pyridine-2-carbonyl]amino]-4-chlorobenzoate (PubChem CID 109217873) has the molecular formula C19H22ClN3O3 and a molecular weight of 375.86 g/mol. Its IUPAC name is methyl 3-[[4-[butyl(methyl)amino]pyridine-2-carbonyl]amino]-4-chlorobenzoate.
| Compound Name | methyl 3-[[4-[butyl(methyl)amino]pyridine-2-carbonyl]amino]-4-chlorobenzoate |
|---|---|
| PubChem CID | 109217873 |
| Molecular Formula | C19H22ClN3O3 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | methyl 3-[[4-[butyl(methyl)amino]pyridine-2-carbonyl]amino]-4-chlorobenzoate |
| SMILES | CCCCN(C)c1ccnc(C(=O)Nc2cc(C(=O)OC)ccc2Cl)c1 |
| InChI | InChI=1S/C19H22ClN3O3/c1-4-5-10-23(2)14-8-9-21-17(12-14)18(24)22-16-11-13(19(25)26-3)6-7-15(16)20/h6-9,11-12H,4-5,10H2,1-3H3,(H,22,24) |
| InChIKey | FLYFAGIDYDNTHZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |