C17H16ClN3O3 — CID 109202416
methyl 4-chloro-3-[[4-(prop-2-enylamino)pyridine-2-carbonyl]amino]benzoate (PubChem CID 109202416) has the molecular formula C17H16ClN3O3 and a molecular weight of 345.79 g/mol. Its IUPAC name is methyl 4-chloro-3-[[4-(prop-2-enylamino)pyridine-2-carbonyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[4-(prop-2-enylamino)pyridine-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109202416 |
| Molecular Formula | C17H16ClN3O3 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | methyl 4-chloro-3-[[4-(prop-2-enylamino)pyridine-2-carbonyl]amino]benzoate |
| SMILES | C=CCNc1ccnc(C(=O)Nc2cc(C(=O)OC)ccc2Cl)c1 |
| InChI | InChI=1S/C17H16ClN3O3/c1-3-7-19-12-6-8-20-15(10-12)16(22)21-14-9-11(17(23)24-2)4-5-13(14)18/h3-6,8-10H,1,7H2,2H3,(H,19,20)(H,21,22) |
| InChIKey | HWVHWEPJQWMFJH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|