C17H17ClN4O3 — CID 109361305
methyl 4-chloro-3-[[2-methyl-6-(prop-2-enylamino)pyrimidine-4-carbonyl]amino]benzoate (PubChem CID 109361305) has the molecular formula C17H17ClN4O3 and a molecular weight of 360.80 g/mol. Its IUPAC name is methyl 4-chloro-3-[[2-methyl-6-(prop-2-enylamino)pyrimidine-4-carbonyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[2-methyl-6-(prop-2-enylamino)pyrimidine-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109361305 |
| Molecular Formula | C17H17ClN4O3 |
| Molecular Weight | 360.80 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | methyl 4-chloro-3-[[2-methyl-6-(prop-2-enylamino)pyrimidine-4-carbonyl]amino]benzoate |
| SMILES | C=CCNc1cc(C(=O)Nc2cc(C(=O)OC)ccc2Cl)nc(C)n1 |
| InChI | InChI=1S/C17H17ClN4O3/c1-4-7-19-15-9-14(20-10(2)21-15)16(23)22-13-8-11(17(24)25-3)5-6-12(13)18/h4-6,8-9H,1,7H2,2-3H3,(H,22,23)(H,19,20,21) |
| InChIKey | SYIVNGZYUJLPLF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.80 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|