C19H23ClN4O3 — CID 109333151
methyl 4-chloro-3-[[6-methyl-2-(3-methylbutylamino)pyrimidine-4-carbonyl]amino]benzoate (PubChem CID 109333151) has the molecular formula C19H23ClN4O3 and a molecular weight of 390.87 g/mol. Its IUPAC name is methyl 4-chloro-3-[[6-methyl-2-(3-methylbutylamino)pyrimidine-4-carbonyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[6-methyl-2-(3-methylbutylamino)pyrimidine-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109333151 |
| Molecular Formula | C19H23ClN4O3 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | methyl 4-chloro-3-[[6-methyl-2-(3-methylbutylamino)pyrimidine-4-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)c2cc(C)nc(NCCC(C)C)n2)c1 |
| InChI | InChI=1S/C19H23ClN4O3/c1-11(2)7-8-21-19-22-12(3)9-16(24-19)17(25)23-15-10-13(18(26)27-4)5-6-14(15)20/h5-6,9-11H,7-8H2,1-4H3,(H,23,25)(H,21,22,24) |
| InChIKey | UVZBIQCLRUUXHM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |