C17H21ClN4O3 — CID 112912009
methyl 4-chloro-3-[[2-(3-methoxypropylamino)-6-methylpyrimidin-4-yl]amino]benzoate (PubChem CID 112912009) has the molecular formula C17H21ClN4O3 and a molecular weight of 364.83 g/mol. Its IUPAC name is methyl 4-chloro-3-[[2-(3-methoxypropylamino)-6-methylpyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[2-(3-methoxypropylamino)-6-methylpyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 112912009 |
| Molecular Formula | C17H21ClN4O3 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | methyl 4-chloro-3-[[2-(3-methoxypropylamino)-6-methylpyrimidin-4-yl]amino]benzoate |
| SMILES | COCCCNc1nc(C)cc(Nc2cc(C(=O)OC)ccc2Cl)n1 |
| InChI | InChI=1S/C17H21ClN4O3/c1-11-9-15(22-17(20-11)19-7-4-8-24-2)21-14-10-12(16(23)25-3)5-6-13(14)18/h5-6,9-10H,4,7-8H2,1-3H3,(H2,19,20,21,22) |
| InChIKey | NYXJWFQTMNFYTE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|