C18H20ClN3O4 — CID 109167103
methyl 4-chloro-3-[[4-(3-methoxypropylcarbamoyl)-2-pyridinyl]amino]benzoate (PubChem CID 109167103) has the molecular formula C18H20ClN3O4 and a molecular weight of 377.83 g/mol. Its IUPAC name is methyl 4-chloro-3-[[4-(3-methoxypropylcarbamoyl)-2-pyridinyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[4-(3-methoxypropylcarbamoyl)-2-pyridinyl]amino]benzoate |
|---|---|
| PubChem CID | 109167103 |
| Molecular Formula | C18H20ClN3O4 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | methyl 4-chloro-3-[[4-(3-methoxypropylcarbamoyl)-2-pyridinyl]amino]benzoate |
| SMILES | COCCCNC(=O)c1ccnc(Nc2cc(C(=O)OC)ccc2Cl)c1 |
| InChI | InChI=1S/C18H20ClN3O4/c1-25-9-3-7-21-17(23)12-6-8-20-16(11-12)22-15-10-13(18(24)26-2)4-5-14(15)19/h4-6,8,10-11H,3,7,9H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | UMJTZWHRSVGRKL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|