C17H19ClN4O3 — CID 109340147
methyl 3-[[6-(butylcarbamoyl)pyrimidin-4-yl]amino]-4-chlorobenzoate (PubChem CID 109340147) has the molecular formula C17H19ClN4O3 and a molecular weight of 362.82 g/mol. Its IUPAC name is methyl 3-[[6-(butylcarbamoyl)pyrimidin-4-yl]amino]-4-chlorobenzoate.
| Compound Name | methyl 3-[[6-(butylcarbamoyl)pyrimidin-4-yl]amino]-4-chlorobenzoate |
|---|---|
| PubChem CID | 109340147 |
| Molecular Formula | C17H19ClN4O3 |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | methyl 3-[[6-(butylcarbamoyl)pyrimidin-4-yl]amino]-4-chlorobenzoate |
| SMILES | CCCCNC(=O)c1cc(Nc2cc(C(=O)OC)ccc2Cl)ncn1 |
| InChI | InChI=1S/C17H19ClN4O3/c1-3-4-7-19-16(23)14-9-15(21-10-20-14)22-13-8-11(17(24)25-2)5-6-12(13)18/h5-6,8-10H,3-4,7H2,1-2H3,(H,19,23)(H,20,21,22) |
| InChIKey | BOPBPUVBDNESIL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|