C16H20N4O3 — CID 113194573
2-[[2-(3-methoxypropylamino)-6-methylpyrimidin-4-yl]amino]benzoic acid (PubChem CID 113194573) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is 2-[[2-(3-methoxypropylamino)-6-methylpyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 2-[[2-(3-methoxypropylamino)-6-methylpyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 113194573 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 2-[[2-(3-methoxypropylamino)-6-methylpyrimidin-4-yl]amino]benzoic acid |
| SMILES | COCCCNc1nc(C)cc(Nc2ccccc2C(=O)O)n1 |
| InChI | InChI=1S/C16H20N4O3/c1-11-10-14(20-16(18-11)17-8-5-9-23-2)19-13-7-4-3-6-12(13)15(21)22/h3-4,6-7,10H,5,8-9H2,1-2H3,(H,21,22)(H2,17,18,19,20) |
| InChIKey | WBAOSFCCLNJNPJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|