C21H22N4O2 — CID 113194649
2-[[6-methyl-2-(2,4,6-trimethylanilino)pyrimidin-4-yl]amino]benzoic acid (PubChem CID 113194649) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is 2-[[6-methyl-2-(2,4,6-trimethylanilino)pyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 2-[[6-methyl-2-(2,4,6-trimethylanilino)pyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 113194649 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 2-[[6-methyl-2-(2,4,6-trimethylanilino)pyrimidin-4-yl]amino]benzoic acid |
| SMILES | Cc1cc(C)c(Nc2nc(C)cc(Nc3ccccc3C(=O)O)n2)c(C)c1 |
| InChI | InChI=1S/C21H22N4O2/c1-12-9-13(2)19(14(3)10-12)25-21-22-15(4)11-18(24-21)23-17-8-6-5-7-16(17)20(26)27/h5-11H,1-4H3,(H,26,27)(H2,22,23,24,25) |
| InChIKey | RLGPNARXCBIONO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |