C18H20ClN3O3 — CID 109174778
methyl 4-chloro-3-[[2-(diethylamino)pyridine-4-carbonyl]amino]benzoate (PubChem CID 109174778) has the molecular formula C18H20ClN3O3 and a molecular weight of 361.83 g/mol. Its IUPAC name is methyl 4-chloro-3-[[2-(diethylamino)pyridine-4-carbonyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[2-(diethylamino)pyridine-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109174778 |
| Molecular Formula | C18H20ClN3O3 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | methyl 4-chloro-3-[[2-(diethylamino)pyridine-4-carbonyl]amino]benzoate |
| SMILES | CCN(CC)c1cc(C(=O)Nc2cc(C(=O)OC)ccc2Cl)ccn1 |
| InChI | InChI=1S/C18H20ClN3O3/c1-4-22(5-2)16-11-12(8-9-20-16)17(23)21-15-10-13(18(24)25-3)6-7-14(15)19/h6-11H,4-5H2,1-3H3,(H,21,23) |
| InChIKey | GLODVJREVUXDDU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |