C19H20ClN3O4 — CID 109099029
methyl 4-chloro-3-[[6-(diethylcarbamoyl)pyridine-2-carbonyl]amino]benzoate (PubChem CID 109099029) has the molecular formula C19H20ClN3O4 and a molecular weight of 389.84 g/mol. Its IUPAC name is methyl 4-chloro-3-[[6-(diethylcarbamoyl)pyridine-2-carbonyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[6-(diethylcarbamoyl)pyridine-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109099029 |
| Molecular Formula | C19H20ClN3O4 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | methyl 4-chloro-3-[[6-(diethylcarbamoyl)pyridine-2-carbonyl]amino]benzoate |
| SMILES | CCN(CC)C(=O)c1cccc(C(=O)Nc2cc(C(=O)OC)ccc2Cl)n1 |
| InChI | InChI=1S/C19H20ClN3O4/c1-4-23(5-2)18(25)15-8-6-7-14(21-15)17(24)22-16-11-12(19(26)27-3)9-10-13(16)20/h6-11H,4-5H2,1-3H3,(H,22,24) |
| InChIKey | JULHLUAVGWVTOC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |