C15H22ClN3O3 — CID 108995150
methyl 4-chloro-3-[[2-[3-(dimethylamino)propylamino]acetyl]amino]benzoate (PubChem CID 108995150) has the molecular formula C15H22ClN3O3 and a molecular weight of 327.81 g/mol. Its IUPAC name is methyl 4-chloro-3-[[2-[3-(dimethylamino)propylamino]acetyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[2-[3-(dimethylamino)propylamino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 108995150 |
| Molecular Formula | C15H22ClN3O3 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | methyl 4-chloro-3-[[2-[3-(dimethylamino)propylamino]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)CNCCCN(C)C)c1 |
| InChI | InChI=1S/C15H22ClN3O3/c1-19(2)8-4-7-17-10-14(20)18-13-9-11(15(21)22-3)5-6-12(13)16/h5-6,9,17H,4,7-8,10H2,1-3H3,(H,18,20) |
| InChIKey | SISOFBCQONLOAF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|