C12H14Cl2N2O2 — CID 39370052
N-(2,5-dichlorophenyl)-N',N'-diethyloxamide (PubChem CID 39370052) has the molecular formula C12H14Cl2N2O2 and a molecular weight of 289.16 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-N',N'-diethyloxamide.
| Compound Name | N-(2,5-dichlorophenyl)-N',N'-diethyloxamide |
|---|---|
| PubChem CID | 39370052 |
| Molecular Formula | C12H14Cl2N2O2 |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | N-(2,5-dichlorophenyl)-N',N'-diethyloxamide |
| SMILES | CCN(CC)C(=O)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H14Cl2N2O2/c1-3-16(4-2)12(18)11(17)15-10-7-8(13)5-6-9(10)14/h5-7H,3-4H2,1-2H3,(H,15,17) |
| InChIKey | BJMJDTGQLBNZIZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|