C9H7Cl2NO3 — CID 11543309
methyl 2-(2,5-dichloroanilino)-2-oxoacetate (PubChem CID 11543309) has the molecular formula C9H7Cl2NO3 and a molecular weight of 248.06 g/mol. Its IUPAC name is methyl 2-(2,5-dichloroanilino)-2-oxoacetate.
| Compound Name | methyl 2-(2,5-dichloroanilino)-2-oxoacetate |
|---|---|
| PubChem CID | 11543309 |
| Molecular Formula | C9H7Cl2NO3 |
| Molecular Weight | 248.06 g/mol |
| Exact Mass | 246.98 |
| IUPAC Name | methyl 2-(2,5-dichloroanilino)-2-oxoacetate |
| SMILES | COC(=O)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C9H7Cl2NO3/c1-15-9(14)8(13)12-7-4-5(10)2-3-6(7)11/h2-4H,1H3,(H,12,13) |
| InChIKey | VXVMGLNJXOSBDD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.06 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|