C12H14Cl2N2O3 — CID 54998078
methyl 2-[(2,5-dichlorophenyl)carbamoyl-ethylamino]acetate (PubChem CID 54998078) has the molecular formula C12H14Cl2N2O3 and a molecular weight of 305.16 g/mol. Its IUPAC name is methyl 2-[(2,5-dichlorophenyl)carbamoyl-ethylamino]acetate.
| Compound Name | methyl 2-[(2,5-dichlorophenyl)carbamoyl-ethylamino]acetate |
|---|---|
| PubChem CID | 54998078 |
| Molecular Formula | C12H14Cl2N2O3 |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | methyl 2-[(2,5-dichlorophenyl)carbamoyl-ethylamino]acetate |
| SMILES | CCN(CC(=O)OC)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H14Cl2N2O3/c1-3-16(7-11(17)19-2)12(18)15-10-6-8(13)4-5-9(10)14/h4-6H,3,7H2,1-2H3,(H,15,18) |
| InChIKey | IDOJSECMYZWVFU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |