methyl 2-[(2,5-dichlorophenyl)carbamoyl-ethylamino]acetate

C12H14Cl2N2O3 — CID 54998078

IUPACmethyl 2-[(2,5-dichlorophenyl)carbamoyl-ethylamino]acetate
SMILESCCN(CC(=O)OC)C(=O)Nc1cc(Cl)ccc1Cl
InChIInChI=1S/C12H14Cl2N2O3/c1-3-16(7-11(17)19-2)12(18)15-10-6-8(13)4-5-9(10)14/h4-6H,3,7H2,1-2H3,(H,15,18)
InChIKeyIDOJSECMYZWVFU-UHFFFAOYSA-N
MW305.16 g/mol
LogP3.02
Rot. Bonds4

About methyl 2-[(2,5-dichlorophenyl)carbamoyl-ethylamino]acetate

methyl 2-[(2,5-dichlorophenyl)carbamoyl-ethylamino]acetate (PubChem CID 54998078) has the molecular formula C12H14Cl2N2O3 and a molecular weight of 305.16 g/mol. Its IUPAC name is methyl 2-[(2,5-dichlorophenyl)carbamoyl-ethylamino]acetate.

Molecular Properties

Compound Namemethyl 2-[(2,5-dichlorophenyl)carbamoyl-ethylamino]acetate
PubChem CID54998078
Molecular FormulaC12H14Cl2N2O3
Molecular Weight305.16 g/mol
Exact Mass304.04
IUPAC Namemethyl 2-[(2,5-dichlorophenyl)carbamoyl-ethylamino]acetate
SMILESCCN(CC(=O)OC)C(=O)Nc1cc(Cl)ccc1Cl
InChIInChI=1S/C12H14Cl2N2O3/c1-3-16(7-11(17)19-2)12(18)15-10-6-8(13)4-5-9(10)14/h4-6H,3,7H2,1-2H3,(H,15,18)
InChIKeyIDOJSECMYZWVFU-UHFFFAOYSA-N
XLogP3.02
TPSA58.64 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500305.16
LogP ≤ 53.02
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 2-[(2,5-dichlorophenyl)carbamoyl-ethylamino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(2,5-dichlorophenyl)carbamoyl-ethylamino]acetate?
The IUPAC name of methyl 2-[(2,5-dichlorophenyl)carbamoyl-ethylamino]acetate (CID 54998078) is methyl 2-[(2,5-dichlorophenyl)carbamoyl-ethylamino]acetate.
What is the SMILES notation for methyl 2-[(2,5-dichlorophenyl)carbamoyl-ethylamino]acetate?
The canonical SMILES for methyl 2-[(2,5-dichlorophenyl)carbamoyl-ethylamino]acetate is CCN(CC(=O)OC)C(=O)Nc1cc(Cl)ccc1Cl.
What is the InChIKey of methyl 2-[(2,5-dichlorophenyl)carbamoyl-ethylamino]acetate?
The InChIKey is IDOJSECMYZWVFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14Cl2N2O3/c1-3-16(7-11(17)19-2)12(18)15-10-6-8(13)4-5-9(10)14/h4-6H,3,7H2,1-2H3,(H,15,18).
What are the key properties of methyl 2-[(2,5-dichlorophenyl)carbamoyl-ethylamino]acetate?
methyl 2-[(2,5-dichlorophenyl)carbamoyl-ethylamino]acetate has a molecular weight of 305.16 g/mol, XLogP of 3.02, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2,5-dichlorophenyl)carbamoyl-ethylamino]acetate is sourced from PubChem (CID 54998078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).