C11H14ClFN2O2 — CID 110930823
3-(2-chloro-5-fluorophenyl)-1-ethyl-1-(2-hydroxyethyl)urea (PubChem CID 110930823) has the molecular formula C11H14ClFN2O2 and a molecular weight of 260.70 g/mol. Its IUPAC name is 3-(2-chloro-5-fluorophenyl)-1-ethyl-1-(2-hydroxyethyl)urea.
| Compound Name | 3-(2-chloro-5-fluorophenyl)-1-ethyl-1-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 110930823 |
| Molecular Formula | C11H14ClFN2O2 |
| Molecular Weight | 260.70 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 3-(2-chloro-5-fluorophenyl)-1-ethyl-1-(2-hydroxyethyl)urea |
| SMILES | CCN(CCO)C(=O)Nc1cc(F)ccc1Cl |
| InChI | InChI=1S/C11H14ClFN2O2/c1-2-15(5-6-16)11(17)14-10-7-8(13)3-4-9(10)12/h3-4,7,16H,2,5-6H2,1H3,(H,14,17) |
| InChIKey | AMLSBQLVJVTZNH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.70 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |