C12H14F2N2O3 — CID 47336227
N-(2,4-difluorophenyl)-N'-ethyl-N'-(2-hydroxyethyl)oxamide (PubChem CID 47336227) has the molecular formula C12H14F2N2O3 and a molecular weight of 272.25 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-N'-ethyl-N'-(2-hydroxyethyl)oxamide.
| Compound Name | N-(2,4-difluorophenyl)-N'-ethyl-N'-(2-hydroxyethyl)oxamide |
|---|---|
| PubChem CID | 47336227 |
| Molecular Formula | C12H14F2N2O3 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | N-(2,4-difluorophenyl)-N'-ethyl-N'-(2-hydroxyethyl)oxamide |
| SMILES | CCN(CCO)C(=O)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C12H14F2N2O3/c1-2-16(5-6-17)12(19)11(18)15-10-4-3-8(13)7-9(10)14/h3-4,7,17H,2,5-6H2,1H3,(H,15,18) |
| InChIKey | BFFIDIOSHGGFAX-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|