C13H17N3O4 — CID 108525152
N-(2-carbamoylphenyl)-N'-ethyl-N'-(2-hydroxyethyl)oxamide (PubChem CID 108525152) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is N-(2-carbamoylphenyl)-N'-ethyl-N'-(2-hydroxyethyl)oxamide.
| Compound Name | N-(2-carbamoylphenyl)-N'-ethyl-N'-(2-hydroxyethyl)oxamide |
|---|---|
| PubChem CID | 108525152 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | N-(2-carbamoylphenyl)-N'-ethyl-N'-(2-hydroxyethyl)oxamide |
| SMILES | CCN(CCO)C(=O)C(=O)Nc1ccccc1C(N)=O |
| InChI | InChI=1S/C13H17N3O4/c1-2-16(7-8-17)13(20)12(19)15-10-6-4-3-5-9(10)11(14)18/h3-6,17H,2,7-8H2,1H3,(H2,14,18)(H,15,19) |
| InChIKey | YZWFWBVYWFRKNE-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|