C13H15N3O4 — CID 108501514
N-(2-cyanophenyl)-N',N'-bis(2-hydroxyethyl)oxamide (PubChem CID 108501514) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is N-(2-cyanophenyl)-N',N'-bis(2-hydroxyethyl)oxamide.
| Compound Name | N-(2-cyanophenyl)-N',N'-bis(2-hydroxyethyl)oxamide |
|---|---|
| PubChem CID | 108501514 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | N-(2-cyanophenyl)-N',N'-bis(2-hydroxyethyl)oxamide |
| SMILES | N#Cc1ccccc1NC(=O)C(=O)N(CCO)CCO |
| InChI | InChI=1S/C13H15N3O4/c14-9-10-3-1-2-4-11(10)15-12(19)13(20)16(5-7-17)6-8-18/h1-4,17-18H,5-8H2,(H,15,19) |
| InChIKey | QIMQXZYVSJBZTQ-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 113.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|