About N'-acetyl-N'-(3-aminophenyl)-N-(2-cyanophenyl)oxamide
N'-acetyl-N'-(3-aminophenyl)-N-(2-cyanophenyl)oxamide (PubChem CID 108501598) has the molecular formula C17H14N4O3
and a molecular weight of 322.32 g/mol. Its IUPAC name is N'-acetyl-N'-(3-aminophenyl)-N-(2-cyanophenyl)oxamide.
Molecular Properties
| Compound Name | N'-acetyl-N'-(3-aminophenyl)-N-(2-cyanophenyl)oxamide |
| PubChem CID | 108501598 |
| Molecular Formula | C17H14N4O3 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | N'-acetyl-N'-(3-aminophenyl)-N-(2-cyanophenyl)oxamide |
| SMILES | CC(=O)N(C(=O)C(=O)Nc1ccccc1C#N)c1cccc(N)c1 |
| InChI | InChI=1S/C17H14N4O3/c1-11(22)21(14-7-4-6-13(19)9-14)17(24)16(23)20-15-8-3-2-5-12(15)10-18/h2-9H,19H2,1H3,(H,20,23) |
| InChIKey | MYAPZQPETNABGX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 116.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-acetyl-N'-(3-aminophenyl)-N-(2-cyanophenyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-acetyl-N'-(3-aminophenyl)-N-(2-cyanophenyl)oxamide?
The IUPAC name of N'-acetyl-N'-(3-aminophenyl)-N-(2-cyanophenyl)oxamide (CID 108501598) is N'-acetyl-N'-(3-aminophenyl)-N-(2-cyanophenyl)oxamide.
What is the SMILES notation for N'-acetyl-N'-(3-aminophenyl)-N-(2-cyanophenyl)oxamide?
The canonical SMILES for N'-acetyl-N'-(3-aminophenyl)-N-(2-cyanophenyl)oxamide is CC(=O)N(C(=O)C(=O)Nc1ccccc1C#N)c1cccc(N)c1.
What is the InChIKey of N'-acetyl-N'-(3-aminophenyl)-N-(2-cyanophenyl)oxamide?
The InChIKey is MYAPZQPETNABGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N4O3/c1-11(22)21(14-7-4-6-13(19)9-14)17(24)16(23)20-15-8-3-2-5-12(15)10-18/h2-9H,19H2,1H3,(H,20,23).
What are the key properties of N'-acetyl-N'-(3-aminophenyl)-N-(2-cyanophenyl)oxamide?
N'-acetyl-N'-(3-aminophenyl)-N-(2-cyanophenyl)oxamide has a molecular weight of 322.32 g/mol, XLogP of 1.66, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-acetyl-N'-(3-aminophenyl)-N-(2-cyanophenyl)oxamide is sourced from PubChem (CID 108501598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).