C20H15N3O — CID 3830875
3-(2-cyanophenyl)-1,1-diphenylurea (PubChem CID 3830875) has the molecular formula C20H15N3O and a molecular weight of 313.36 g/mol. Its IUPAC name is 3-(2-cyanophenyl)-1,1-diphenylurea.
| Compound Name | 3-(2-cyanophenyl)-1,1-diphenylurea |
|---|---|
| PubChem CID | 3830875 |
| Molecular Formula | C20H15N3O |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 3-(2-cyanophenyl)-1,1-diphenylurea |
| SMILES | N#Cc1ccccc1NC(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H15N3O/c21-15-16-9-7-8-14-19(16)22-20(24)23(17-10-3-1-4-11-17)18-12-5-2-6-13-18/h1-14H,(H,22,24) |
| InChIKey | FULJVPQLZKLXGC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |