C18H20N2O4S — CID 108509806
N',N'-bis(2-hydroxyethyl)-N-(2-phenylsulfanylphenyl)oxamide (PubChem CID 108509806) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is N',N'-bis(2-hydroxyethyl)-N-(2-phenylsulfanylphenyl)oxamide.
| Compound Name | N',N'-bis(2-hydroxyethyl)-N-(2-phenylsulfanylphenyl)oxamide |
|---|---|
| PubChem CID | 108509806 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | N',N'-bis(2-hydroxyethyl)-N-(2-phenylsulfanylphenyl)oxamide |
| SMILES | O=C(Nc1ccccc1Sc1ccccc1)C(=O)N(CCO)CCO |
| InChI | InChI=1S/C18H20N2O4S/c21-12-10-20(11-13-22)18(24)17(23)19-15-8-4-5-9-16(15)25-14-6-2-1-3-7-14/h1-9,21-22H,10-13H2,(H,19,23) |
| InChIKey | UYUPXTSUXWOTFC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|