C16H15NOS — CID 162717598
N-(2-phenylsulfanylphenyl)but-3-enamide (PubChem CID 162717598) has the molecular formula C16H15NOS and a molecular weight of 269.37 g/mol. Its IUPAC name is N-(2-phenylsulfanylphenyl)but-3-enamide.
| Compound Name | N-(2-phenylsulfanylphenyl)but-3-enamide |
|---|---|
| PubChem CID | 162717598 |
| Molecular Formula | C16H15NOS |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | N-(2-phenylsulfanylphenyl)but-3-enamide |
| SMILES | C=CCC(=O)Nc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C16H15NOS/c1-2-8-16(18)17-14-11-6-7-12-15(14)19-13-9-4-3-5-10-13/h2-7,9-12H,1,8H2,(H,17,18) |
| InChIKey | JSPNLTSIBLHOML-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|