C16H25N3O3 — CID 108525164
N-[4-(diethylamino)phenyl]-N'-ethyl-N'-(2-hydroxyethyl)oxamide (PubChem CID 108525164) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-N'-ethyl-N'-(2-hydroxyethyl)oxamide.
| Compound Name | N-[4-(diethylamino)phenyl]-N'-ethyl-N'-(2-hydroxyethyl)oxamide |
|---|---|
| PubChem CID | 108525164 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-N'-ethyl-N'-(2-hydroxyethyl)oxamide |
| SMILES | CCN(CCO)C(=O)C(=O)Nc1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C16H25N3O3/c1-4-18(5-2)14-9-7-13(8-10-14)17-15(21)16(22)19(6-3)11-12-20/h7-10,20H,4-6,11-12H2,1-3H3,(H,17,21) |
| InChIKey | SYACOSSGGJEKLI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|