C16H16F2N2O — CID 108989059
1-benzyl-3-(2,4-difluorophenyl)-1-ethylurea (PubChem CID 108989059) has the molecular formula C16H16F2N2O and a molecular weight of 290.31 g/mol. Its IUPAC name is 1-benzyl-3-(2,4-difluorophenyl)-1-ethylurea.
| Compound Name | 1-benzyl-3-(2,4-difluorophenyl)-1-ethylurea |
|---|---|
| PubChem CID | 108989059 |
| Molecular Formula | C16H16F2N2O |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 1-benzyl-3-(2,4-difluorophenyl)-1-ethylurea |
| SMILES | CCN(Cc1ccccc1)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C16H16F2N2O/c1-2-20(11-12-6-4-3-5-7-12)16(21)19-15-9-8-13(17)10-14(15)18/h3-10H,2,11H2,1H3,(H,19,21) |
| InChIKey | GRPMWCKZPNQOLR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |