C21H19F2N3O — CID 109157649
N-benzyl-6-(2,4-difluoroanilino)-N-ethylpyridine-3-carboxamide (PubChem CID 109157649) has the molecular formula C21H19F2N3O and a molecular weight of 367.40 g/mol. Its IUPAC name is N-benzyl-6-(2,4-difluoroanilino)-N-ethylpyridine-3-carboxamide.
| Compound Name | N-benzyl-6-(2,4-difluoroanilino)-N-ethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 109157649 |
| Molecular Formula | C21H19F2N3O |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | N-benzyl-6-(2,4-difluoroanilino)-N-ethylpyridine-3-carboxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)c1ccc(Nc2ccc(F)cc2F)nc1 |
| InChI | InChI=1S/C21H19F2N3O/c1-2-26(14-15-6-4-3-5-7-15)21(27)16-8-11-20(24-13-16)25-19-10-9-17(22)12-18(19)23/h3-13H,2,14H2,1H3,(H,24,25) |
| InChIKey | NHPRGSGRNRICMK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |