C21H18F3N3O — CID 109157654
N-benzyl-N-ethyl-6-(2,3,4-trifluoroanilino)pyridine-3-carboxamide (PubChem CID 109157654) has the molecular formula C21H18F3N3O and a molecular weight of 385.39 g/mol. Its IUPAC name is N-benzyl-N-ethyl-6-(2,3,4-trifluoroanilino)pyridine-3-carboxamide.
| Compound Name | N-benzyl-N-ethyl-6-(2,3,4-trifluoroanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109157654 |
| Molecular Formula | C21H18F3N3O |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | N-benzyl-N-ethyl-6-(2,3,4-trifluoroanilino)pyridine-3-carboxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)c1ccc(Nc2ccc(F)c(F)c2F)nc1 |
| InChI | InChI=1S/C21H18F3N3O/c1-2-27(13-14-6-4-3-5-7-14)21(28)15-8-11-18(25-12-15)26-17-10-9-16(22)19(23)20(17)24/h3-12H,2,13H2,1H3,(H,25,26) |
| InChIKey | RKKDGBYMDKPLEV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|