C20H15F4N3O — CID 109158740
N-[2-(4-fluorophenyl)ethyl]-6-(2,3,4-trifluoroanilino)pyridine-3-carboxamide (PubChem CID 109158740) has the molecular formula C20H15F4N3O and a molecular weight of 389.35 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-6-(2,3,4-trifluoroanilino)pyridine-3-carboxamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-6-(2,3,4-trifluoroanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109158740 |
| Molecular Formula | C20H15F4N3O |
| Molecular Weight | 389.35 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-6-(2,3,4-trifluoroanilino)pyridine-3-carboxamide |
| SMILES | O=C(NCCc1ccc(F)cc1)c1ccc(Nc2ccc(F)c(F)c2F)nc1 |
| InChI | InChI=1S/C20H15F4N3O/c21-14-4-1-12(2-5-14)9-10-25-20(28)13-3-8-17(26-11-13)27-16-7-6-15(22)18(23)19(16)24/h1-8,11H,9-10H2,(H,25,28)(H,26,27) |
| InChIKey | NLGWNQQYLNMDCM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.35 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|