C19H24FN3O — CID 109158696
N-[2-(4-fluorophenyl)ethyl]-6-(pentylamino)pyridine-3-carboxamide (PubChem CID 109158696) has the molecular formula C19H24FN3O and a molecular weight of 329.42 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-6-(pentylamino)pyridine-3-carboxamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-6-(pentylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109158696 |
| Molecular Formula | C19H24FN3O |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-6-(pentylamino)pyridine-3-carboxamide |
| SMILES | CCCCCNc1ccc(C(=O)NCCc2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C19H24FN3O/c1-2-3-4-12-21-18-10-7-16(14-23-18)19(24)22-13-11-15-5-8-17(20)9-6-15/h5-10,14H,2-4,11-13H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | CWEIKZBZOAIOKJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|