C18H18F2N2O3 — CID 42697996
methyl 3-[benzyl-[(2,4-difluorophenyl)carbamoyl]amino]propanoate (PubChem CID 42697996) has the molecular formula C18H18F2N2O3 and a molecular weight of 348.35 g/mol. Its IUPAC name is methyl 3-[benzyl-[(2,4-difluorophenyl)carbamoyl]amino]propanoate.
| Compound Name | methyl 3-[benzyl-[(2,4-difluorophenyl)carbamoyl]amino]propanoate |
|---|---|
| PubChem CID | 42697996 |
| Molecular Formula | C18H18F2N2O3 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | methyl 3-[benzyl-[(2,4-difluorophenyl)carbamoyl]amino]propanoate |
| SMILES | COC(=O)CCN(Cc1ccccc1)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C18H18F2N2O3/c1-25-17(23)9-10-22(12-13-5-3-2-4-6-13)18(24)21-16-8-7-14(19)11-15(16)20/h2-8,11H,9-10,12H2,1H3,(H,21,24) |
| InChIKey | VMHJJRBBVYURRI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |