C19H22ClFN2O2 — CID 47489067
1-benzyl-3-(2-chloro-4-fluorophenyl)-1-(4-methoxybutyl)urea (PubChem CID 47489067) has the molecular formula C19H22ClFN2O2 and a molecular weight of 364.85 g/mol. Its IUPAC name is 1-benzyl-3-(2-chloro-4-fluorophenyl)-1-(4-methoxybutyl)urea.
| Compound Name | 1-benzyl-3-(2-chloro-4-fluorophenyl)-1-(4-methoxybutyl)urea |
|---|---|
| PubChem CID | 47489067 |
| Molecular Formula | C19H22ClFN2O2 |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 1-benzyl-3-(2-chloro-4-fluorophenyl)-1-(4-methoxybutyl)urea |
| SMILES | COCCCCN(Cc1ccccc1)C(=O)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C19H22ClFN2O2/c1-25-12-6-5-11-23(14-15-7-3-2-4-8-15)19(24)22-18-10-9-16(21)13-17(18)20/h2-4,7-10,13H,5-6,11-12,14H2,1H3,(H,22,24) |
| InChIKey | DVRCAWGQOGLRKA-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|