C26H29Cl2N3O3S — CID 3271245
N-benzyl-2-[(2,4-dichlorophenyl)carbamoyl-(3-methoxypropyl)amino]-N-[(3-methylthiophen-2-yl)methyl]acetamide (PubChem CID 3271245) has the molecular formula C26H29Cl2N3O3S and a molecular weight of 534.51 g/mol. Its IUPAC name is N-benzyl-2-[(2,4-dichlorophenyl)carbamoyl-(3-methoxypropyl)amino]-N-[(3-methylthiophen-2-yl)methyl]acetamide.
| Compound Name | N-benzyl-2-[(2,4-dichlorophenyl)carbamoyl-(3-methoxypropyl)amino]-N-[(3-methylthiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 3271245 |
| Molecular Formula | C26H29Cl2N3O3S |
| Molecular Weight | 534.51 g/mol |
| Exact Mass | 533.13 |
| IUPAC Name | N-benzyl-2-[(2,4-dichlorophenyl)carbamoyl-(3-methoxypropyl)amino]-N-[(3-methylthiophen-2-yl)methyl]acetamide |
| SMILES | COCCCN(CC(=O)N(Cc1ccccc1)Cc1sccc1C)C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H29Cl2N3O3S/c1-19-11-14-35-24(19)17-31(16-20-7-4-3-5-8-20)25(32)18-30(12-6-13-34-2)26(33)29-23-10-9-21(27)15-22(23)28/h3-5,7-11,14-15H,6,12-13,16-18H2,1-2H3,(H,29,33) |
| InChIKey | IHAFBSHELKJATB-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.51 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|