C23H24ClF2N3O2 — CID 4041810
1-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-3-(2,4-difluorophenyl)-1-(3-methoxypropyl)urea (PubChem CID 4041810) has the molecular formula C23H24ClF2N3O2 and a molecular weight of 447.91 g/mol. Its IUPAC name is 1-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-3-(2,4-difluorophenyl)-1-(3-methoxypropyl)urea.
| Compound Name | 1-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-3-(2,4-difluorophenyl)-1-(3-methoxypropyl)urea |
|---|---|
| PubChem CID | 4041810 |
| Molecular Formula | C23H24ClF2N3O2 |
| Molecular Weight | 447.91 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 1-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-3-(2,4-difluorophenyl)-1-(3-methoxypropyl)urea |
| SMILES | COCCCN(Cc1cccn1Cc1ccccc1Cl)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C23H24ClF2N3O2/c1-31-13-5-12-29(23(30)27-22-10-9-18(25)14-21(22)26)16-19-7-4-11-28(19)15-17-6-2-3-8-20(17)24/h2-4,6-11,14H,5,12-13,15-16H2,1H3,(H,27,30) |
| InChIKey | SVMMEUIYCMXWLI-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.91 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|