C23H24Cl2N2O2 — CID 4679079
4-chloro-N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(3-methoxypropyl)benzamide (PubChem CID 4679079) has the molecular formula C23H24Cl2N2O2 and a molecular weight of 431.36 g/mol. Its IUPAC name is 4-chloro-N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(3-methoxypropyl)benzamide.
| Compound Name | 4-chloro-N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 4679079 |
| Molecular Formula | C23H24Cl2N2O2 |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 4-chloro-N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCN(Cc1cccn1Cc1ccccc1Cl)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H24Cl2N2O2/c1-29-15-5-14-27(23(28)18-9-11-20(24)12-10-18)17-21-7-4-13-26(21)16-19-6-2-3-8-22(19)25/h2-4,6-13H,5,14-17H2,1H3 |
| InChIKey | BBVQZEJTWXUKEZ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|