C24H27ClN2O3 — CID 3275693
N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-2-methoxy-N-(3-methoxypropyl)benzamide (PubChem CID 3275693) has the molecular formula C24H27ClN2O3 and a molecular weight of 426.94 g/mol. Its IUPAC name is N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-2-methoxy-N-(3-methoxypropyl)benzamide.
| Compound Name | N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-2-methoxy-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 3275693 |
| Molecular Formula | C24H27ClN2O3 |
| Molecular Weight | 426.94 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-2-methoxy-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCN(Cc1cccn1Cc1ccccc1Cl)C(=O)c1ccccc1OC |
| InChI | InChI=1S/C24H27ClN2O3/c1-29-16-8-15-27(24(28)21-11-4-6-13-23(21)30-2)18-20-10-7-14-26(20)17-19-9-3-5-12-22(19)25/h3-7,9-14H,8,15-18H2,1-2H3 |
| InChIKey | WTCIBCTXKVHDEX-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.94 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|