C27H33ClN2O3 — CID 4617611
4-butoxy-N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(3-methoxypropyl)benzamide (PubChem CID 4617611) has the molecular formula C27H33ClN2O3 and a molecular weight of 469.03 g/mol. Its IUPAC name is 4-butoxy-N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(3-methoxypropyl)benzamide.
| Compound Name | 4-butoxy-N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 4617611 |
| Molecular Formula | C27H33ClN2O3 |
| Molecular Weight | 469.03 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 4-butoxy-N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(3-methoxypropyl)benzamide |
| SMILES | CCCCOc1ccc(C(=O)N(CCCOC)Cc2cccn2Cc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C27H33ClN2O3/c1-3-4-19-33-25-14-12-22(13-15-25)27(31)30(17-8-18-32-2)21-24-10-7-16-29(24)20-23-9-5-6-11-26(23)28/h5-7,9-16H,3-4,8,17-21H2,1-2H3 |
| InChIKey | PKOCRBVLAPZDQV-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.03 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|