C22H22Cl2N2O2 — CID 4612906
2-chloro-N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(2-methoxyethyl)benzamide (PubChem CID 4612906) has the molecular formula C22H22Cl2N2O2 and a molecular weight of 417.34 g/mol. Its IUPAC name is 2-chloro-N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(2-methoxyethyl)benzamide.
| Compound Name | 2-chloro-N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 4612906 |
| Molecular Formula | C22H22Cl2N2O2 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 2-chloro-N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCN(Cc1cccn1Cc1ccccc1Cl)C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C22H22Cl2N2O2/c1-28-14-13-26(22(27)19-9-3-5-11-21(19)24)16-18-8-6-12-25(18)15-17-7-2-4-10-20(17)23/h2-12H,13-16H2,1H3 |
| InChIKey | GZLNOVYBUOWTTC-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |