C23H24ClN3O4 — CID 4679082
N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(2-methoxyethyl)-4-methyl-3-nitrobenzamide (PubChem CID 4679082) has the molecular formula C23H24ClN3O4 and a molecular weight of 441.92 g/mol. Its IUPAC name is N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(2-methoxyethyl)-4-methyl-3-nitrobenzamide.
| Compound Name | N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(2-methoxyethyl)-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 4679082 |
| Molecular Formula | C23H24ClN3O4 |
| Molecular Weight | 441.92 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(2-methoxyethyl)-4-methyl-3-nitrobenzamide |
| SMILES | COCCN(Cc1cccn1Cc1ccccc1Cl)C(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H24ClN3O4/c1-17-9-10-18(14-22(17)27(29)30)23(28)26(12-13-31-2)16-20-7-5-11-25(20)15-19-6-3-4-8-21(19)24/h3-11,14H,12-13,15-16H2,1-2H3 |
| InChIKey | YJVASNFKLCPKPT-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 77.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.92 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|