C24H27N3O3 — CID 42764421
N-[(1-benzylpyrrol-2-yl)methyl]-N-butan-2-yl-4-methyl-3-nitrobenzamide (PubChem CID 42764421) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-[(1-benzylpyrrol-2-yl)methyl]-N-butan-2-yl-4-methyl-3-nitrobenzamide.
| Compound Name | N-[(1-benzylpyrrol-2-yl)methyl]-N-butan-2-yl-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 42764421 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | N-[(1-benzylpyrrol-2-yl)methyl]-N-butan-2-yl-4-methyl-3-nitrobenzamide |
| SMILES | CCC(C)N(Cc1cccn1Cc1ccccc1)C(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H27N3O3/c1-4-19(3)26(24(28)21-13-12-18(2)23(15-21)27(29)30)17-22-11-8-14-25(22)16-20-9-6-5-7-10-20/h5-15,19H,4,16-17H2,1-3H3 |
| InChIKey | KCOLGWBKMQPSIH-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 68.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|