C28H30N2O — CID 7398373
N-[(1-benzylpyrrol-2-yl)methyl]-N-[(2S)-3-methylbutan-2-yl]naphthalene-2-carboxamide (PubChem CID 7398373) has the molecular formula C28H30N2O and a molecular weight of 410.56 g/mol. Its IUPAC name is N-[(1-benzylpyrrol-2-yl)methyl]-N-[(2S)-3-methylbutan-2-yl]naphthalene-2-carboxamide.
| Compound Name | N-[(1-benzylpyrrol-2-yl)methyl]-N-[(2S)-3-methylbutan-2-yl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 7398373 |
| Molecular Formula | C28H30N2O |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | N-[(1-benzylpyrrol-2-yl)methyl]-N-[(2S)-3-methylbutan-2-yl]naphthalene-2-carboxamide |
| SMILES | CC(C)[C@H](C)N(Cc1cccn1Cc1ccccc1)C(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H30N2O/c1-21(2)22(3)30(28(31)26-16-15-24-12-7-8-13-25(24)18-26)20-27-14-9-17-29(27)19-23-10-5-4-6-11-23/h4-18,21-22H,19-20H2,1-3H3/t22-/m0/s1 |
| InChIKey | GFBWOKLYDCEERC-QFIPXVFZSA-N |
| XLogP | 6.38 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |