C30H32N2O — CID 42663176
N-[(1-benzylpyrrol-2-yl)methyl]-N-(3-methylbutan-2-yl)-4-phenylbenzamide (PubChem CID 42663176) has the molecular formula C30H32N2O and a molecular weight of 436.60 g/mol. Its IUPAC name is N-[(1-benzylpyrrol-2-yl)methyl]-N-(3-methylbutan-2-yl)-4-phenylbenzamide.
| Compound Name | N-[(1-benzylpyrrol-2-yl)methyl]-N-(3-methylbutan-2-yl)-4-phenylbenzamide |
|---|---|
| PubChem CID | 42663176 |
| Molecular Formula | C30H32N2O |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | N-[(1-benzylpyrrol-2-yl)methyl]-N-(3-methylbutan-2-yl)-4-phenylbenzamide |
| SMILES | CC(C)C(C)N(Cc1cccn1Cc1ccccc1)C(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H32N2O/c1-23(2)24(3)32(22-29-15-10-20-31(29)21-25-11-6-4-7-12-25)30(33)28-18-16-27(17-19-28)26-13-8-5-9-14-26/h4-20,23-24H,21-22H2,1-3H3 |
| InChIKey | SCAALZYIZLXUPQ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |