C29H38N2O — CID 7327311
N-[(1-benzylpyrrol-2-yl)methyl]-N-[(2R)-butan-2-yl]-4-hexylbenzamide (PubChem CID 7327311) has the molecular formula C29H38N2O and a molecular weight of 430.64 g/mol. Its IUPAC name is N-[(1-benzylpyrrol-2-yl)methyl]-N-[(2R)-butan-2-yl]-4-hexylbenzamide.
| Compound Name | N-[(1-benzylpyrrol-2-yl)methyl]-N-[(2R)-butan-2-yl]-4-hexylbenzamide |
|---|---|
| PubChem CID | 7327311 |
| Molecular Formula | C29H38N2O |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 430.30 |
| IUPAC Name | N-[(1-benzylpyrrol-2-yl)methyl]-N-[(2R)-butan-2-yl]-4-hexylbenzamide |
| SMILES | CCCCCCc1ccc(C(=O)N(Cc2cccn2Cc2ccccc2)[C@H](C)CC)cc1 |
| InChI | InChI=1S/C29H38N2O/c1-4-6-7-9-13-25-17-19-27(20-18-25)29(32)31(24(3)5-2)23-28-16-12-21-30(28)22-26-14-10-8-11-15-26/h8,10-12,14-21,24H,4-7,9,13,22-23H2,1-3H3/t24-/m1/s1 |
| InChIKey | CZBXRMCOPDWWDR-XMMPIXPASA-N |
| XLogP | 7.10 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|