C37H45N3O2 — CID 4555596
N-[2-[benzyl-[(1-benzylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-(2-methylpropyl)-4-pentylbenzamide (PubChem CID 4555596) has the molecular formula C37H45N3O2 and a molecular weight of 563.79 g/mol. Its IUPAC name is N-[2-[benzyl-[(1-benzylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-(2-methylpropyl)-4-pentylbenzamide.
| Compound Name | N-[2-[benzyl-[(1-benzylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-(2-methylpropyl)-4-pentylbenzamide |
|---|---|
| PubChem CID | 4555596 |
| Molecular Formula | C37H45N3O2 |
| Molecular Weight | 563.79 g/mol |
| Exact Mass | 563.35 |
| IUPAC Name | N-[2-[benzyl-[(1-benzylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-(2-methylpropyl)-4-pentylbenzamide |
| SMILES | CCCCCc1ccc(C(=O)N(CC(=O)N(Cc2ccccc2)Cc2cccn2Cc2ccccc2)CC(C)C)cc1 |
| InChI | InChI=1S/C37H45N3O2/c1-4-5-8-14-31-20-22-34(23-21-31)37(42)40(25-30(2)3)29-36(41)39(27-33-17-11-7-12-18-33)28-35-19-13-24-38(35)26-32-15-9-6-10-16-32/h6-7,9-13,15-24,30H,4-5,8,14,25-29H2,1-3H3 |
| InChIKey | ABMHIKSFIDPBHD-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.79 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|