C28H43N3O2 — CID 3458486
4-hexyl-N-[2-[2-methylpropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-propan-2-ylbenzamide (PubChem CID 3458486) has the molecular formula C28H43N3O2 and a molecular weight of 453.67 g/mol. Its IUPAC name is 4-hexyl-N-[2-[2-methylpropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-propan-2-ylbenzamide.
| Compound Name | 4-hexyl-N-[2-[2-methylpropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 3458486 |
| Molecular Formula | C28H43N3O2 |
| Molecular Weight | 453.67 g/mol |
| Exact Mass | 453.34 |
| IUPAC Name | 4-hexyl-N-[2-[2-methylpropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-propan-2-ylbenzamide |
| SMILES | CCCCCCc1ccc(C(=O)N(CC(=O)N(Cc2cccn2C)CC(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C28H43N3O2/c1-7-8-9-10-12-24-14-16-25(17-15-24)28(33)31(23(4)5)21-27(32)30(19-22(2)3)20-26-13-11-18-29(26)6/h11,13-18,22-23H,7-10,12,19-21H2,1-6H3 |
| InChIKey | XNHIIRXUCNIQHT-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.67 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|