C24H30N2O2 — CID 3936154
N-(furan-2-ylmethyl)-4-hexyl-N-[(1-methylpyrrol-2-yl)methyl]benzamide (PubChem CID 3936154) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-hexyl-N-[(1-methylpyrrol-2-yl)methyl]benzamide.
| Compound Name | N-(furan-2-ylmethyl)-4-hexyl-N-[(1-methylpyrrol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 3936154 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-hexyl-N-[(1-methylpyrrol-2-yl)methyl]benzamide |
| SMILES | CCCCCCc1ccc(C(=O)N(Cc2ccco2)Cc2cccn2C)cc1 |
| InChI | InChI=1S/C24H30N2O2/c1-3-4-5-6-9-20-12-14-21(15-13-20)24(27)26(19-23-11-8-17-28-23)18-22-10-7-16-25(22)2/h7-8,10-17H,3-6,9,18-19H2,1-2H3 |
| InChIKey | LGFDTNHIVODRHT-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 38.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|