C19H17F3N2O2 — CID 42760198
N-(furan-2-ylmethyl)-N-[(1-methylpyrrol-2-yl)methyl]-4-(trifluoromethyl)benzamide (PubChem CID 42760198) has the molecular formula C19H17F3N2O2 and a molecular weight of 362.35 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-[(1-methylpyrrol-2-yl)methyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-(furan-2-ylmethyl)-N-[(1-methylpyrrol-2-yl)methyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 42760198 |
| Molecular Formula | C19H17F3N2O2 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-[(1-methylpyrrol-2-yl)methyl]-4-(trifluoromethyl)benzamide |
| SMILES | Cn1cccc1CN(Cc1ccco1)C(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H17F3N2O2/c1-23-10-2-4-16(23)12-24(13-17-5-3-11-26-17)18(25)14-6-8-15(9-7-14)19(20,21)22/h2-11H,12-13H2,1H3 |
| InChIKey | XPOAJPYZPITTIF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 38.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |