C17H17F3N2O — CID 42759947
N-[(1-methylpyrrol-2-yl)methyl]-N-prop-2-enyl-4-(trifluoromethyl)benzamide (PubChem CID 42759947) has the molecular formula C17H17F3N2O and a molecular weight of 322.33 g/mol. Its IUPAC name is N-[(1-methylpyrrol-2-yl)methyl]-N-prop-2-enyl-4-(trifluoromethyl)benzamide.
| Compound Name | N-[(1-methylpyrrol-2-yl)methyl]-N-prop-2-enyl-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 42759947 |
| Molecular Formula | C17H17F3N2O |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | N-[(1-methylpyrrol-2-yl)methyl]-N-prop-2-enyl-4-(trifluoromethyl)benzamide |
| SMILES | C=CCN(Cc1cccn1C)C(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H17F3N2O/c1-3-10-22(12-15-5-4-11-21(15)2)16(23)13-6-8-14(9-7-13)17(18,19)20/h3-9,11H,1,10,12H2,2H3 |
| InChIKey | OPXJMXKAVPOFNQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|