C16H17N3O3 — CID 42759910
N-[(1-methylpyrrol-2-yl)methyl]-4-nitro-N-prop-2-enylbenzamide (PubChem CID 42759910) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is N-[(1-methylpyrrol-2-yl)methyl]-4-nitro-N-prop-2-enylbenzamide.
| Compound Name | N-[(1-methylpyrrol-2-yl)methyl]-4-nitro-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 42759910 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | N-[(1-methylpyrrol-2-yl)methyl]-4-nitro-N-prop-2-enylbenzamide |
| SMILES | C=CCN(Cc1cccn1C)C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H17N3O3/c1-3-10-18(12-15-5-4-11-17(15)2)16(20)13-6-8-14(9-7-13)19(21)22/h3-9,11H,1,10,12H2,2H3 |
| InChIKey | JQMGPJWNDLDIJX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 68.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|