C23H24N2O — CID 42759925
N-[(1-methylpyrrol-2-yl)methyl]-2,2-diphenyl-N-prop-2-enylacetamide (PubChem CID 42759925) has the molecular formula C23H24N2O and a molecular weight of 344.46 g/mol. Its IUPAC name is N-[(1-methylpyrrol-2-yl)methyl]-2,2-diphenyl-N-prop-2-enylacetamide.
| Compound Name | N-[(1-methylpyrrol-2-yl)methyl]-2,2-diphenyl-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 42759925 |
| Molecular Formula | C23H24N2O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | N-[(1-methylpyrrol-2-yl)methyl]-2,2-diphenyl-N-prop-2-enylacetamide |
| SMILES | C=CCN(Cc1cccn1C)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H24N2O/c1-3-16-25(18-21-15-10-17-24(21)2)23(26)22(19-11-6-4-7-12-19)20-13-8-5-9-14-20/h3-15,17,22H,1,16,18H2,2H3 |
| InChIKey | RDFADPUALAFHHX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|